C19H26F3N8O7S+ — CID 173425100
(Z)-4-[1-methyl-2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-ium-1-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 173425100) has the molecular formula C19H26F3N8O7S+ and a molecular weight of 567.53 g/mol. Its IUPAC name is (Z)-4-[1-methyl-2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-ium-1-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[1-methyl-2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-ium-1-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 173425100 |
| Molecular Formula | C19H26F3N8O7S+ |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | (Z)-4-[1-methyl-2-methylsulfonylimino-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]imidazolidin-1-ium-1-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | C[N+]1(OC(=O)/C=C\C(=O)O)CCN(CCCOc2nccc(N/C(N)=N/CC(F)(F)F)n2)C1=NS(C)(=O)=O |
| InChI | InChI=1S/C19H25F3N8O7S/c1-30(37-15(33)5-4-14(31)32)10-9-29(18(30)28-38(2,34)35)8-3-11-36-17-24-7-6-13(27-17)26-16(23)25-12-19(20,21)22/h4-7H,3,8-12H2,1-2H3,(H3-,23,24,25,26,27,31,32)/p+1/b5-4-,28-18? |
| InChIKey | CHZVMOLBFBZMSI-DGUJJSEQSA-O |
| XLogP | -0.29 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|