C18H22F3N7OS — CID 88779446
3-phenyl-1-sulfanyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]urea (PubChem CID 88779446) has the molecular formula C18H22F3N7OS and a molecular weight of 441.48 g/mol. Its IUPAC name is 3-phenyl-1-sulfanyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]urea.
| Compound Name | 3-phenyl-1-sulfanyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]urea |
|---|---|
| PubChem CID | 88779446 |
| Molecular Formula | C18H22F3N7OS |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-phenyl-1-sulfanyl-1-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]urea |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(CCCCN(S)C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H22F3N7OS/c19-18(20,21)12-24-16(22)27-15-9-10-23-14(26-15)8-4-5-11-28(30)17(29)25-13-6-2-1-3-7-13/h1-3,6-7,9-10,30H,4-5,8,11-12H2,(H,25,29)(H3,22,23,24,26,27) |
| InChIKey | WCVSGCOLIMITGP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|