C9H17N3O2S4 — CID 88679811
carbamothioic S-acid;methane;2-(1,3-thiazol-2-ylmethylsulfanyl)ethylcarbamothioic S-acid (PubChem CID 88679811) has the molecular formula C9H17N3O2S4 and a molecular weight of 327.52 g/mol. Its IUPAC name is carbamothioic S-acid;methane;2-(1,3-thiazol-2-ylmethylsulfanyl)ethylcarbamothioic S-acid.
| Compound Name | carbamothioic S-acid;methane;2-(1,3-thiazol-2-ylmethylsulfanyl)ethylcarbamothioic S-acid |
|---|---|
| PubChem CID | 88679811 |
| Molecular Formula | C9H17N3O2S4 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | carbamothioic S-acid;methane;2-(1,3-thiazol-2-ylmethylsulfanyl)ethylcarbamothioic S-acid |
| SMILES | C.NC(=O)S.O=C(S)NCCSCc1nccs1 |
| InChI | InChI=1S/C7H10N2OS3.CH3NOS.CH4/c10-7(11)9-1-3-12-5-6-8-2-4-13-6;2-1(3)4;/h2,4H,1,3,5H2,(H2,9,10,11);(H3,2,3,4);1H4 |
| InChIKey | VUZHQCMHPZOHGO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|