C14H19ClO2 — CID 177478541
(1R,2R,6S,7R)-10-[(E)-1-chloroprop-1-en-2-yl]-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene (PubChem CID 177478541) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is (1R,2R,6S,7R)-10-[(E)-1-chloroprop-1-en-2-yl]-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene.
| Compound Name | (1R,2R,6S,7R)-10-[(E)-1-chloroprop-1-en-2-yl]-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene |
|---|---|
| PubChem CID | 177478541 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (1R,2R,6S,7R)-10-[(E)-1-chloroprop-1-en-2-yl]-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene |
| SMILES | C/C(=C\Cl)C1C[C@@H]2C=C[C@H]1[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H19ClO2/c1-8(7-15)11-6-9-4-5-10(11)13-12(9)16-14(2,3)17-13/h4-5,7,9-13H,6H2,1-3H3/b8-7+/t9-,10+,11?,12-,13+/m0/s1 |
| InChIKey | AWKFTQOTKXXVCC-UOXKWTGASA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|