C32H36O6 — CID 11191557
(3aR,5R,6R,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-ethenyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 11191557) has the molecular formula C32H36O6 and a molecular weight of 516.63 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-ethenyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6R,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-ethenyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11191557 |
| Molecular Formula | C32H36O6 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-ethenyl-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | C=C[C@@]1(OCc2ccccc2)[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C32H36O6/c1-4-32(35-22-26-18-12-7-13-19-26)28(36-30-29(32)37-31(2,3)38-30)27(34-21-25-16-10-6-11-17-25)23-33-20-24-14-8-5-9-15-24/h4-19,27-30H,1,20-23H2,2-3H3/t27-,28-,29+,30-,32-/m1/s1 |
| InChIKey | BGRWAXBOVYPOOW-LTGXLJKXSA-N |
| XLogP | 5.81 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|