C22H28Cl3NO6 — CID 132583492
N-[(3aR,5S,6S,6aR)-6-ethenyl-5-[(2S)-1-hydroxy-4-phenylmethoxybutan-2-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide (PubChem CID 132583492) has the molecular formula C22H28Cl3NO6 and a molecular weight of 508.83 g/mol. Its IUPAC name is N-[(3aR,5S,6S,6aR)-6-ethenyl-5-[(2S)-1-hydroxy-4-phenylmethoxybutan-2-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(3aR,5S,6S,6aR)-6-ethenyl-5-[(2S)-1-hydroxy-4-phenylmethoxybutan-2-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 132583492 |
| Molecular Formula | C22H28Cl3NO6 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | N-[(3aR,5S,6S,6aR)-6-ethenyl-5-[(2S)-1-hydroxy-4-phenylmethoxybutan-2-yl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide |
| SMILES | C=C[C@]1(NC(=O)C(Cl)(Cl)Cl)[C@H]([C@H](CO)CCOCc2ccccc2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H28Cl3NO6/c1-4-21(26-19(28)22(23,24)25)16(30-18-17(21)31-20(2,3)32-18)15(12-27)10-11-29-13-14-8-6-5-7-9-14/h4-9,15-18,27H,1,10-13H2,2-3H3,(H,26,28)/t15-,16-,17-,18+,21-/m0/s1 |
| InChIKey | YCUCKRUWRNYUDC-HQMXNFIDSA-N |
| XLogP | 3.49 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|