C17H22Br2O2 — CID 101387059
3-[(2R)-4,4-dibromo-2-(2-phenylmethoxyethyl)but-3-enyl]-2,2-dimethyloxirane (PubChem CID 101387059) has the molecular formula C17H22Br2O2 and a molecular weight of 418.17 g/mol. Its IUPAC name is 3-[(2R)-4,4-dibromo-2-(2-phenylmethoxyethyl)but-3-enyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(2R)-4,4-dibromo-2-(2-phenylmethoxyethyl)but-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 101387059 |
| Molecular Formula | C17H22Br2O2 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 3-[(2R)-4,4-dibromo-2-(2-phenylmethoxyethyl)but-3-enyl]-2,2-dimethyloxirane |
| SMILES | CC1(C)OC1CC(C=C(Br)Br)CCOCc1ccccc1 |
| InChI | InChI=1S/C17H22Br2O2/c1-17(2)15(21-17)10-14(11-16(18)19)8-9-20-12-13-6-4-3-5-7-13/h3-7,11,14-15H,8-10,12H2,1-2H3 |
| InChIKey | XNOZJCNOAROBKZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|