C14H15Br2NO — CID 86224027
5,5-dibromo-2-(2-phenylmethoxyethyl)pent-4-enenitrile (PubChem CID 86224027) has the molecular formula C14H15Br2NO and a molecular weight of 373.09 g/mol. Its IUPAC name is 5,5-dibromo-2-(2-phenylmethoxyethyl)pent-4-enenitrile.
| Compound Name | 5,5-dibromo-2-(2-phenylmethoxyethyl)pent-4-enenitrile |
|---|---|
| PubChem CID | 86224027 |
| Molecular Formula | C14H15Br2NO |
| Molecular Weight | 373.09 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 5,5-dibromo-2-(2-phenylmethoxyethyl)pent-4-enenitrile |
| SMILES | N#CC(CC=C(Br)Br)CCOCc1ccccc1 |
| InChI | InChI=1S/C14H15Br2NO/c15-14(16)7-6-12(10-17)8-9-18-11-13-4-2-1-3-5-13/h1-5,7,12H,6,8-9,11H2 |
| InChIKey | PVSVUWNEQDIXPK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.09 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|