C20H23NO2 — CID 15739741
(2S,3R)-3-methyl-2,5-bis(phenylmethoxy)pentanenitrile (PubChem CID 15739741) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2,5-bis(phenylmethoxy)pentanenitrile.
| Compound Name | (2S,3R)-3-methyl-2,5-bis(phenylmethoxy)pentanenitrile |
|---|---|
| PubChem CID | 15739741 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S,3R)-3-methyl-2,5-bis(phenylmethoxy)pentanenitrile |
| SMILES | C[C@H](CCOCc1ccccc1)[C@@H](C#N)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-17(12-13-22-15-18-8-4-2-5-9-18)20(14-21)23-16-19-10-6-3-7-11-19/h2-11,17,20H,12-13,15-16H2,1H3/t17-,20-/m1/s1 |
| InChIKey | KPUSDQHKYYAYKO-YLJYHZDGSA-N |
| XLogP | 4.34 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|