C19H24O3 — CID 15168221
(3S)-3,5-bis(phenylmethoxy)pentan-1-ol (PubChem CID 15168221) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3S)-3,5-bis(phenylmethoxy)pentan-1-ol.
| Compound Name | (3S)-3,5-bis(phenylmethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 15168221 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3S)-3,5-bis(phenylmethoxy)pentan-1-ol |
| SMILES | OCC[C@@H](CCOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H24O3/c20-13-11-19(22-16-18-9-5-2-6-10-18)12-14-21-15-17-7-3-1-4-8-17/h1-10,19-20H,11-16H2/t19-/m0/s1 |
| InChIKey | TYBIGXLKWPMYHZ-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|