C18H23NO3 — CID 14814233
O-[(2S)-1,4-bis(phenylmethoxy)butan-2-yl]hydroxylamine (PubChem CID 14814233) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is O-[(2S)-1,4-bis(phenylmethoxy)butan-2-yl]hydroxylamine.
| Compound Name | O-[(2S)-1,4-bis(phenylmethoxy)butan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 14814233 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | O-[(2S)-1,4-bis(phenylmethoxy)butan-2-yl]hydroxylamine |
| SMILES | NO[C@@H](CCOCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c19-22-18(15-21-14-17-9-5-2-6-10-17)11-12-20-13-16-7-3-1-4-8-16/h1-10,18H,11-15,19H2/t18-/m0/s1 |
| InChIKey | PBQJZEMEOUHKBX-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|