C17H24Br2O — CID 134859312
[(3R)-9,9-dibromo-3-methylnon-8-enoxy]methylbenzene (PubChem CID 134859312) has the molecular formula C17H24Br2O and a molecular weight of 404.19 g/mol. Its IUPAC name is [(3R)-9,9-dibromo-3-methylnon-8-enoxy]methylbenzene.
| Compound Name | [(3R)-9,9-dibromo-3-methylnon-8-enoxy]methylbenzene |
|---|---|
| PubChem CID | 134859312 |
| Molecular Formula | C17H24Br2O |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | [(3R)-9,9-dibromo-3-methylnon-8-enoxy]methylbenzene |
| SMILES | C[C@H](CCCCC=C(Br)Br)CCOCc1ccccc1 |
| InChI | InChI=1S/C17H24Br2O/c1-15(8-4-2-7-11-17(18)19)12-13-20-14-16-9-5-3-6-10-16/h3,5-6,9-11,15H,2,4,7-8,12-14H2,1H3/t15-/m1/s1 |
| InChIKey | RHZWQYQNZVLGBT-OAHLLOKOSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|