C18H28O3 — CID 71659208
4,4-dimethyl-5-[(3S)-3-methyl-5-phenylmethoxypentyl]-1,3-dioxolane (PubChem CID 71659208) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 4,4-dimethyl-5-[(3S)-3-methyl-5-phenylmethoxypentyl]-1,3-dioxolane.
| Compound Name | 4,4-dimethyl-5-[(3S)-3-methyl-5-phenylmethoxypentyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 71659208 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 4,4-dimethyl-5-[(3S)-3-methyl-5-phenylmethoxypentyl]-1,3-dioxolane |
| SMILES | C[C@H](CCOCc1ccccc1)CCC1OCOC1(C)C |
| InChI | InChI=1S/C18H28O3/c1-15(9-10-17-18(2,3)21-14-20-17)11-12-19-13-16-7-5-4-6-8-16/h4-8,15,17H,9-14H2,1-3H3/t15-,17?/m0/s1 |
| InChIKey | GBQIEOMPBJQVRQ-MYJWUSKBSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|