C21H26Cl3NO5 — CID 78114697
2,2,2-trichloro-N-[4-(dimethoxymethyl)-3-ethenyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide (PubChem CID 78114697) has the molecular formula C21H26Cl3NO5 and a molecular weight of 478.80 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(dimethoxymethyl)-3-ethenyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(dimethoxymethyl)-3-ethenyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide |
|---|---|
| PubChem CID | 78114697 |
| Molecular Formula | C21H26Cl3NO5 |
| Molecular Weight | 478.80 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(dimethoxymethyl)-3-ethenyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide |
| SMILES | C=CC1(NC(=O)C(Cl)(Cl)Cl)C(C(OC)OC)CC2(C)OC2C1OCc1ccccc1 |
| InChI | InChI=1S/C21H26Cl3NO5/c1-5-20(25-18(26)21(22,23)24)14(17(27-3)28-4)11-19(2)15(30-19)16(20)29-12-13-9-7-6-8-10-13/h5-10,14-17H,1,11-12H2,2-4H3,(H,25,26) |
| InChIKey | QJEYEADJZFDILU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|