C35H44N2O7 — CID 70469630
1,3,3-trimethyl-6-phenylmethoxy-N-[[(1R,4S,6S)-1,3,3-trimethyl-6-phenylmethoxy-2-oxabicyclo[2.2.1]heptane-4-carbonyl]carbamoyl]-2-oxabicyclo[2.2.1]heptane-4-carboxamide (PubChem CID 70469630) has the molecular formula C35H44N2O7 and a molecular weight of 604.74 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-phenylmethoxy-N-[[(1R,4S,6S)-1,3,3-trimethyl-6-phenylmethoxy-2-oxabicyclo[2.2.1]heptane-4-carbonyl]carbamoyl]-2-oxabicyclo[2.2.1]heptane-4-carboxamide.
| Compound Name | 1,3,3-trimethyl-6-phenylmethoxy-N-[[(1R,4S,6S)-1,3,3-trimethyl-6-phenylmethoxy-2-oxabicyclo[2.2.1]heptane-4-carbonyl]carbamoyl]-2-oxabicyclo[2.2.1]heptane-4-carboxamide |
|---|---|
| PubChem CID | 70469630 |
| Molecular Formula | C35H44N2O7 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 1,3,3-trimethyl-6-phenylmethoxy-N-[[(1R,4S,6S)-1,3,3-trimethyl-6-phenylmethoxy-2-oxabicyclo[2.2.1]heptane-4-carbonyl]carbamoyl]-2-oxabicyclo[2.2.1]heptane-4-carboxamide |
| SMILES | CC12CC(C(=O)NC(=O)NC(=O)[C@@]34C[C@H](OCc5ccccc5)[C@@](C)(C3)OC4(C)C)(CC1OCc1ccccc1)C(C)(C)O2 |
| InChI | InChI=1S/C35H44N2O7/c1-30(2)34(17-25(32(5,21-34)43-30)41-19-23-13-9-7-10-14-23)27(38)36-29(40)37-28(39)35-18-26(33(6,22-35)44-31(35,3)4)42-20-24-15-11-8-12-16-24/h7-16,25-26H,17-22H2,1-6H3,(H2,36,37,38,39,40)/t25-,26?,32+,33?,34+,35?/m0/s1 |
| InChIKey | ZHIZAFYEJZEYHH-PLDHYGTQSA-N |
| XLogP | 5.20 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |