C15H21NO3 — CID 101199184
cis-(1S,2R)-2-hydroxy-4,4-dimethyl-N-phenylmethoxycyclopentane-1-carboxamide (PubChem CID 101199184) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is cis-(1S,2R)-2-hydroxy-4,4-dimethyl-N-phenylmethoxycyclopentane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-hydroxy-4,4-dimethyl-N-phenylmethoxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 101199184 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | cis-(1S,2R)-2-hydroxy-4,4-dimethyl-N-phenylmethoxycyclopentane-1-carboxamide |
| SMILES | CC1(C)C[C@@H](O)[C@@H](C(=O)NOCc2ccccc2)C1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2)8-12(13(17)9-15)14(18)16-19-10-11-6-4-3-5-7-11/h3-7,12-13,17H,8-10H2,1-2H3,(H,16,18)/t12-,13+/m0/s1 |
| InChIKey | IPNYRRSKKVUKDL-QWHCGFSZSA-N |
| XLogP | 2.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|