C12H15N5O3 — CID 59162850
(2S)-4-azido-3-hydroxy-N-phenylmethoxypyrrolidine-2-carboxamide (PubChem CID 59162850) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2S)-4-azido-3-hydroxy-N-phenylmethoxypyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-azido-3-hydroxy-N-phenylmethoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59162850 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (2S)-4-azido-3-hydroxy-N-phenylmethoxypyrrolidine-2-carboxamide |
| SMILES | [N-]=[N+]=NC1CN[C@H](C(=O)NOCc2ccccc2)C1O |
| InChI | InChI=1S/C12H15N5O3/c13-17-15-9-6-14-10(11(9)18)12(19)16-20-7-8-4-2-1-3-5-8/h1-5,9-11,14,18H,6-7H2,(H,16,19)/t9?,10-,11?/m0/s1 |
| InChIKey | YDENVZAJGWBJGE-YVNMAJEFSA-N |
| XLogP | 0.25 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|