C18H23NO6 — CID 100917352
[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 100917352) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | [(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 100917352 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | C=C[C@H](OC(=O)CNC(=O)OCc1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H23NO6/c1-4-14(15-12-23-18(2,3)25-15)24-16(20)10-19-17(21)22-11-13-8-6-5-7-9-13/h4-9,14-15H,1,10-12H2,2-3H3,(H,19,21)/t14-,15+/m0/s1 |
| InChIKey | SHDDAKHPAVEIKK-LSDHHAIUSA-N |
| XLogP | 2.16 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|