C29H30Cl3NO5 — CID 67636668
2,2,2-trichloro-N-[(3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetamide (PubChem CID 67636668) has the molecular formula C29H30Cl3NO5 and a molecular weight of 578.92 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 67636668 |
| Molecular Formula | C29H30Cl3NO5 |
| Molecular Weight | 578.92 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 2,2,2-trichloro-N-[(3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetamide |
| SMILES | C[C@H]1OC(NC(=O)C(Cl)(Cl)Cl)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H30Cl3NO5/c1-20-24(35-17-21-11-5-2-6-12-21)25(36-18-22-13-7-3-8-14-22)26(37-19-23-15-9-4-10-16-23)27(38-20)33-28(34)29(30,31)32/h2-16,20,24-27H,17-19H2,1H3,(H,33,34)/t20-,24+,25+,26-,27?/m1/s1 |
| InChIKey | BDRFQQHUZZJZEA-IBOMKHEGSA-N |
| XLogP | 5.97 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.92 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|