C19H32N2O2 — CID 67933670
1-benzyl-2,2,4,6,6-pentamethylpiperidine;methyl carbamate (PubChem CID 67933670) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-benzyl-2,2,4,6,6-pentamethylpiperidine;methyl carbamate.
| Compound Name | 1-benzyl-2,2,4,6,6-pentamethylpiperidine;methyl carbamate |
|---|---|
| PubChem CID | 67933670 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-benzyl-2,2,4,6,6-pentamethylpiperidine;methyl carbamate |
| SMILES | CC1CC(C)(C)N(Cc2ccccc2)C(C)(C)C1.COC(N)=O |
| InChI | InChI=1S/C17H27N.C2H5NO2/c1-14-11-16(2,3)18(17(4,5)12-14)13-15-9-7-6-8-10-15;1-5-2(3)4/h6-10,14H,11-13H2,1-5H3;1H3,(H2,3,4) |
| InChIKey | LCIBLCOUWVSJLV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |