C19H24Cl3NO5 — CID 134831830
2,2,2-trichloro-1-[(2S,3S,4R)-2-ethenyl-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-4-(2-phenylmethoxyethyl)pyrrolidin-1-yl]ethanone (PubChem CID 134831830) has the molecular formula C19H24Cl3NO5 and a molecular weight of 452.76 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[(2S,3S,4R)-2-ethenyl-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-4-(2-phenylmethoxyethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[(2S,3S,4R)-2-ethenyl-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-4-(2-phenylmethoxyethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134831830 |
| Molecular Formula | C19H24Cl3NO5 |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2,2,2-trichloro-1-[(2S,3S,4R)-2-ethenyl-3,5-dihydroxy-2-(hydroxymethyl)-3-methyl-4-(2-phenylmethoxyethyl)pyrrolidin-1-yl]ethanone |
| SMILES | C=C[C@@]1(CO)N(C(=O)C(Cl)(Cl)Cl)C(O)[C@H](CCOCc2ccccc2)[C@]1(C)O |
| InChI | InChI=1S/C19H24Cl3NO5/c1-3-18(12-24)17(2,27)14(15(25)23(18)16(26)19(20,21)22)9-10-28-11-13-7-5-4-6-8-13/h3-8,14-15,24-25,27H,1,9-12H2,2H3/t14-,15?,17-,18-/m0/s1 |
| InChIKey | BHICQNKFWSSNSD-WZFCQOSNSA-N |
| XLogP | 2.41 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|