C22H30O3 — CID 10854806
(2R,3S,4R)-3-ethenyl-2,3-dimethyl-2-(3-oxobutyl)-4-(phenylmethoxymethyl)cyclohexan-1-one (PubChem CID 10854806) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2R,3S,4R)-3-ethenyl-2,3-dimethyl-2-(3-oxobutyl)-4-(phenylmethoxymethyl)cyclohexan-1-one.
| Compound Name | (2R,3S,4R)-3-ethenyl-2,3-dimethyl-2-(3-oxobutyl)-4-(phenylmethoxymethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 10854806 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2R,3S,4R)-3-ethenyl-2,3-dimethyl-2-(3-oxobutyl)-4-(phenylmethoxymethyl)cyclohexan-1-one |
| SMILES | C=C[C@@]1(C)[C@H](COCc2ccccc2)CCC(=O)[C@]1(C)CCC(C)=O |
| InChI | InChI=1S/C22H30O3/c1-5-21(3)19(16-25-15-18-9-7-6-8-10-18)11-12-20(24)22(21,4)14-13-17(2)23/h5-10,19H,1,11-16H2,2-4H3/t19-,21-,22-/m0/s1 |
| InChIKey | UNIYLCXIJOEYMX-BVSLBCMMSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|