C16H19NO3 — CID 122625875
(3R,4R)-1-methyl-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)azetidin-2-one (PubChem CID 122625875) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (3R,4R)-1-methyl-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)azetidin-2-one.
| Compound Name | (3R,4R)-1-methyl-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)azetidin-2-one |
|---|---|
| PubChem CID | 122625875 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (3R,4R)-1-methyl-3-(2-methylprop-2-enoyl)-4-(phenylmethoxymethyl)azetidin-2-one |
| SMILES | C=C(C)C(=O)[C@@H]1C(=O)N(C)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-11(2)15(18)14-13(17(3)16(14)19)10-20-9-12-7-5-4-6-8-12/h4-8,13-14H,1,9-10H2,2-3H3/t13-,14+/m0/s1 |
| InChIKey | QJBDFHYTVUIGRG-UONOGXRCSA-N |
| XLogP | 1.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|