C34H30BrNO3 — CID 46931265
(3R,4R)-3-(3-bromobut-3-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one (PubChem CID 46931265) has the molecular formula C34H30BrNO3 and a molecular weight of 580.52 g/mol. Its IUPAC name is (3R,4R)-3-(3-bromobut-3-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one.
| Compound Name | (3R,4R)-3-(3-bromobut-3-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
|---|---|
| PubChem CID | 46931265 |
| Molecular Formula | C34H30BrNO3 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | (3R,4R)-3-(3-bromobut-3-enoyl)-4-(phenylmethoxymethyl)-1-tritylazetidin-2-one |
| SMILES | C=C(Br)CC(=O)[C@@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C34H30BrNO3/c1-25(35)22-31(37)32-30(24-39-23-26-14-6-2-7-15-26)36(33(32)38)34(27-16-8-3-9-17-27,28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-21,30,32H,1,22-24H2/t30-,32+/m0/s1 |
| InChIKey | YWXSXSVUJFNZRJ-XDFJSJKPSA-N |
| XLogP | 6.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|