C37H33NO3 — CID 102054850
methyl 4-[(2R,3R)-3-(phenylmethoxymethyl)-1-tritylaziridin-2-yl]benzoate (PubChem CID 102054850) has the molecular formula C37H33NO3 and a molecular weight of 539.68 g/mol. Its IUPAC name is methyl 4-[(2R,3R)-3-(phenylmethoxymethyl)-1-tritylaziridin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,3R)-3-(phenylmethoxymethyl)-1-tritylaziridin-2-yl]benzoate |
|---|---|
| PubChem CID | 102054850 |
| Molecular Formula | C37H33NO3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | methyl 4-[(2R,3R)-3-(phenylmethoxymethyl)-1-tritylaziridin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2[C@H](COCc3ccccc3)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H33NO3/c1-40-36(39)30-24-22-29(23-25-30)35-34(27-41-26-28-14-6-2-7-15-28)38(35)37(31-16-8-3-9-17-31,32-18-10-4-11-19-32)33-20-12-5-13-21-33/h2-25,34-35H,26-27H2,1H3/t34-,35+,38?/m0/s1 |
| InChIKey | BIBAQDQXQGSGPS-BMVFIQMASA-N |
| XLogP | 7.41 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|