C35H31NO — CID 102054848
(2R,3R)-2-phenyl-3-(phenylmethoxymethyl)-1-tritylaziridine (PubChem CID 102054848) has the molecular formula C35H31NO and a molecular weight of 481.64 g/mol. Its IUPAC name is (2R,3R)-2-phenyl-3-(phenylmethoxymethyl)-1-tritylaziridine.
| Compound Name | (2R,3R)-2-phenyl-3-(phenylmethoxymethyl)-1-tritylaziridine |
|---|---|
| PubChem CID | 102054848 |
| Molecular Formula | C35H31NO |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2R,3R)-2-phenyl-3-(phenylmethoxymethyl)-1-tritylaziridine |
| SMILES | c1ccc(COC[C@H]2[C@@H](c3ccccc3)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H31NO/c1-6-16-28(17-7-1)26-37-27-33-34(29-18-8-2-9-19-29)36(33)35(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32/h1-25,33-34H,26-27H2/t33-,34+,36?/m0/s1 |
| InChIKey | NUFUDGWMKZMTBY-WLRRAVMWSA-N |
| XLogP | 7.62 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|