C16H20O6 — CID 11702272
(3aR,5S,6R,6aR)-2,2,5-trimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid (PubChem CID 11702272) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-2,2,5-trimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid.
| Compound Name | (3aR,5S,6R,6aR)-2,2,5-trimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 11702272 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3aR,5S,6R,6aR)-2,2,5-trimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid |
| SMILES | C[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@]1(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H20O6/c1-10-16(14(17)18,19-9-11-7-5-4-6-8-11)12-13(20-10)22-15(2,3)21-12/h4-8,10,12-13H,9H2,1-3H3,(H,17,18)/t10-,12-,13+,16+/m0/s1 |
| InChIKey | SXTLOGZAZONEMK-CNXAATOLSA-N |
| XLogP | 1.92 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |