C13H24 — CID 142247047
1,2,4,5-tetramethyl-3-prop-2-enylcyclohexane (PubChem CID 142247047) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-prop-2-enylcyclohexane.
| Compound Name | 1,2,4,5-tetramethyl-3-prop-2-enylcyclohexane |
|---|---|
| PubChem CID | 142247047 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,2,4,5-tetramethyl-3-prop-2-enylcyclohexane |
| SMILES | C=CCC1C(C)C(C)CC(C)C1C |
| InChI | InChI=1S/C13H24/c1-6-7-13-11(4)9(2)8-10(3)12(13)5/h6,9-13H,1,7-8H2,2-5H3 |
| InChIKey | UWOAVIWREVFCIZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|