C13H22Sn — CID 177398138
trimethyl-[(1S,2S,3R,4R)-3-prop-2-enyl-2-bicyclo[2.2.1]hept-5-enyl]stannane (PubChem CID 177398138) has the molecular formula C13H22Sn and a molecular weight of 297.03 g/mol. Its IUPAC name is trimethyl-[(1S,2S,3R,4R)-3-prop-2-enyl-2-bicyclo[2.2.1]hept-5-enyl]stannane.
| Compound Name | trimethyl-[(1S,2S,3R,4R)-3-prop-2-enyl-2-bicyclo[2.2.1]hept-5-enyl]stannane |
|---|---|
| PubChem CID | 177398138 |
| Molecular Formula | C13H22Sn |
| Molecular Weight | 297.03 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | trimethyl-[(1S,2S,3R,4R)-3-prop-2-enyl-2-bicyclo[2.2.1]hept-5-enyl]stannane |
| SMILES | C=CC[C@H]1[C@@H]([Sn](C)(C)C)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C10H13.3CH3.Sn/c1-2-3-9-6-8-4-5-10(9)7-8;;;;/h2,4-6,8-10H,1,3,7H2;3*1H3;/t8-,9-,10-;;;;/m0..../s1 |
| InChIKey | SGCDKXMPMJHUJQ-OSBAOLSJSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.03 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|