C14H18 — CID 13115978
5-cyclohepta-2,4-dien-1-ylcyclohepta-1,3-diene (PubChem CID 13115978) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 5-cyclohepta-2,4-dien-1-ylcyclohepta-1,3-diene.
| Compound Name | 5-cyclohepta-2,4-dien-1-ylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 13115978 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5-cyclohepta-2,4-dien-1-ylcyclohepta-1,3-diene |
| SMILES | C1=CCCC(C2C=CC=CCC2)C=C1 |
| InChI | InChI=1S/C14H18/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14/h1-5,7,9,11,13-14H,6,8,10,12H2 |
| InChIKey | IKYHEGKNCSPFCW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |