C11H15NO2 — CID 101352281
[(4R,5R)-3-methyl-4-phenyl-1,3-oxazolidin-5-yl]methanol (PubChem CID 101352281) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is [(4R,5R)-3-methyl-4-phenyl-1,3-oxazolidin-5-yl]methanol.
| Compound Name | [(4R,5R)-3-methyl-4-phenyl-1,3-oxazolidin-5-yl]methanol |
|---|---|
| PubChem CID | 101352281 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [(4R,5R)-3-methyl-4-phenyl-1,3-oxazolidin-5-yl]methanol |
| SMILES | CN1CO[C@@H](CO)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-12-8-14-10(7-13)11(12)9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | RDYPNXCAGKYFEK-WDEREUQCSA-N |
| XLogP | 1.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |