C20H25NO2 — CID 134702161
[(2S,3R)-4-[(3,4-dimethylphenyl)methyl]-3-phenylmorpholin-2-yl]methanol (PubChem CID 134702161) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(2S,3R)-4-[(3,4-dimethylphenyl)methyl]-3-phenylmorpholin-2-yl]methanol.
| Compound Name | [(2S,3R)-4-[(3,4-dimethylphenyl)methyl]-3-phenylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 134702161 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(2S,3R)-4-[(3,4-dimethylphenyl)methyl]-3-phenylmorpholin-2-yl]methanol |
| SMILES | Cc1ccc(CN2CCO[C@H](CO)[C@H]2c2ccccc2)cc1C |
| InChI | InChI=1S/C20H25NO2/c1-15-8-9-17(12-16(15)2)13-21-10-11-23-19(14-22)20(21)18-6-4-3-5-7-18/h3-9,12,19-20,22H,10-11,13-14H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | LCCVGBISBBJNAR-WOJBJXKFSA-N |
| XLogP | 3.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |