C19H23NO3 — CID 134709769
[(2S,3R)-4-[(3-methoxyphenyl)methyl]-3-phenylmorpholin-2-yl]methanol (PubChem CID 134709769) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is [(2S,3R)-4-[(3-methoxyphenyl)methyl]-3-phenylmorpholin-2-yl]methanol.
| Compound Name | [(2S,3R)-4-[(3-methoxyphenyl)methyl]-3-phenylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 134709769 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [(2S,3R)-4-[(3-methoxyphenyl)methyl]-3-phenylmorpholin-2-yl]methanol |
| SMILES | COc1cccc(CN2CCO[C@H](CO)[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-22-17-9-5-6-15(12-17)13-20-10-11-23-18(14-21)19(20)16-7-3-2-4-8-16/h2-9,12,18-19,21H,10-11,13-14H2,1H3/t18-,19-/m1/s1 |
| InChIKey | WPDPEYDFCYVQTR-RTBURBONSA-N |
| XLogP | 2.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |