C22H20N2O4 — CID 10690929
(1S,3S,11S,12R,15R)-11,15-diphenyl-5,10,14-trioxa-6,9-diazatetracyclo[7.6.0.01,12.03,7]pentadec-6-en-8-one (PubChem CID 10690929) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (1S,3S,11S,12R,15R)-11,15-diphenyl-5,10,14-trioxa-6,9-diazatetracyclo[7.6.0.01,12.03,7]pentadec-6-en-8-one.
| Compound Name | (1S,3S,11S,12R,15R)-11,15-diphenyl-5,10,14-trioxa-6,9-diazatetracyclo[7.6.0.01,12.03,7]pentadec-6-en-8-one |
|---|---|
| PubChem CID | 10690929 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (1S,3S,11S,12R,15R)-11,15-diphenyl-5,10,14-trioxa-6,9-diazatetracyclo[7.6.0.01,12.03,7]pentadec-6-en-8-one |
| SMILES | O=C1C2=NOC[C@H]2C[C@@]23[C@@H](c4ccccc4)OC[C@@H]2[C@@H](c2ccccc2)ON13 |
| InChI | InChI=1S/C22H20N2O4/c25-21-18-16(12-27-23-18)11-22-17(13-26-20(22)15-9-5-2-6-10-15)19(28-24(21)22)14-7-3-1-4-8-14/h1-10,16-17,19-20H,11-13H2/t16-,17-,19-,20-,22+/m1/s1 |
| InChIKey | MPKVXQNSLAYWQH-WRVJLHSDSA-N |
| XLogP | 3.03 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |