C19H20O2 — CID 11492874
(3R,3aR,6R,6aR)-3a-methyl-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan (PubChem CID 11492874) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3a-methyl-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan.
| Compound Name | (3R,3aR,6R,6aR)-3a-methyl-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan |
|---|---|
| PubChem CID | 11492874 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3R,3aR,6R,6aR)-3a-methyl-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan |
| SMILES | C[C@]12CO[C@@H](c3ccccc3)[C@H]1CO[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c1-19-13-21-17(14-8-4-2-5-9-14)16(19)12-20-18(19)15-10-6-3-7-11-15/h2-11,16-18H,12-13H2,1H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | HSJHKTKCQLCJDM-HCXYKTFWSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |