C18H17FO2 — CID 122232525
(3S,3aS,6S)-3a-fluoro-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan (PubChem CID 122232525) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is (3S,3aS,6S)-3a-fluoro-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan.
| Compound Name | (3S,3aS,6S)-3a-fluoro-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan |
|---|---|
| PubChem CID | 122232525 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3S,3aS,6S)-3a-fluoro-3,6-diphenyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan |
| SMILES | F[C@]12CO[C@H](c3ccccc3)C1CO[C@H]2c1ccccc1 |
| InChI | InChI=1S/C18H17FO2/c19-18-12-21-16(13-7-3-1-4-8-13)15(18)11-20-17(18)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15?,16-,17+,18-/m1/s1 |
| InChIKey | GCPHLNODMAQJLI-HQSKLWIPSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |