C10H6F6O — CID 101101880
(3R)-3-phenyl-2,2-bis(trifluoromethyl)oxirane (PubChem CID 101101880) has the molecular formula C10H6F6O and a molecular weight of 256.15 g/mol. Its IUPAC name is (3R)-3-phenyl-2,2-bis(trifluoromethyl)oxirane.
| Compound Name | (3R)-3-phenyl-2,2-bis(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 101101880 |
| Molecular Formula | C10H6F6O |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (3R)-3-phenyl-2,2-bis(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C1(C(F)(F)F)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H6F6O/c11-9(12,13)8(10(14,15)16)7(17-8)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
| InChIKey | PAXXFFRFXMSIRM-SSDOTTSWSA-N |
| XLogP | 3.62 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|