C14H16F3NO2 — CID 132581946
(1R,6R,7S)-4,4-dimethyl-6-phenyl-1-(trifluoromethyl)-2,8-dioxa-5-azabicyclo[5.1.0]octane (PubChem CID 132581946) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (1R,6R,7S)-4,4-dimethyl-6-phenyl-1-(trifluoromethyl)-2,8-dioxa-5-azabicyclo[5.1.0]octane.
| Compound Name | (1R,6R,7S)-4,4-dimethyl-6-phenyl-1-(trifluoromethyl)-2,8-dioxa-5-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 132581946 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (1R,6R,7S)-4,4-dimethyl-6-phenyl-1-(trifluoromethyl)-2,8-dioxa-5-azabicyclo[5.1.0]octane |
| SMILES | CC1(C)CO[C@@]2(C(F)(F)F)O[C@H]2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C14H16F3NO2/c1-12(2)8-19-13(14(15,16)17)11(20-13)10(18-12)9-6-4-3-5-7-9/h3-7,10-11,18H,8H2,1-2H3/t10-,11+,13-/m1/s1 |
| InChIKey | HFQMUBPKCAQBDU-NTZNESFSSA-N |
| XLogP | 2.78 |
| TPSA | 33.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|