C18H28N2O2 — CID 10924738
(3R,4S,5S)-2-tert-butyl-4,8,8-trimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane (PubChem CID 10924738) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3R,4S,5S)-2-tert-butyl-4,8,8-trimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane.
| Compound Name | (3R,4S,5S)-2-tert-butyl-4,8,8-trimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 10924738 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (3R,4S,5S)-2-tert-butyl-4,8,8-trimethyl-3-phenyl-1,6-dioxa-2,9-diazaspiro[4.4]nonane |
| SMILES | C[C@H]1[C@H](c2ccccc2)N(C(C)(C)C)O[C@]12NC(C)(C)CO2 |
| InChI | InChI=1S/C18H28N2O2/c1-13-15(14-10-8-7-9-11-14)20(16(2,3)4)22-18(13)19-17(5,6)12-21-18/h7-11,13,15,19H,12H2,1-6H3/t13-,15+,18-/m0/s1 |
| InChIKey | CTDXPPXGNXPBEW-JOQOYGCGSA-N |
| XLogP | 3.46 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |