C16H13F3 — CID 132581964
[(1S,2R)-2-phenyl-1-(trifluoromethyl)cyclopropyl]benzene (PubChem CID 132581964) has the molecular formula C16H13F3 and a molecular weight of 262.27 g/mol. Its IUPAC name is [(1S,2R)-2-phenyl-1-(trifluoromethyl)cyclopropyl]benzene.
| Compound Name | [(1S,2R)-2-phenyl-1-(trifluoromethyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 132581964 |
| Molecular Formula | C16H13F3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [(1S,2R)-2-phenyl-1-(trifluoromethyl)cyclopropyl]benzene |
| SMILES | FC(F)(F)[C@@]1(c2ccccc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H13F3/c17-16(18,19)15(13-9-5-2-6-10-13)11-14(15)12-7-3-1-4-8-12/h1-10,14H,11H2/t14-,15-/m1/s1 |
| InChIKey | PYPIEXIIXZNMPB-HUUCEWRRSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |