C18H19F3N2 — CID 67615516
1-methyl-2,3-diphenyl-2-(trifluoromethyl)piperazine (PubChem CID 67615516) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-methyl-2,3-diphenyl-2-(trifluoromethyl)piperazine.
| Compound Name | 1-methyl-2,3-diphenyl-2-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 67615516 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-methyl-2,3-diphenyl-2-(trifluoromethyl)piperazine |
| SMILES | CN1CCNC(c2ccccc2)C1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H19F3N2/c1-23-13-12-22-16(14-8-4-2-5-9-14)17(23,18(19,20)21)15-10-6-3-7-11-15/h2-11,16,22H,12-13H2,1H3 |
| InChIKey | VDPMMLAVPPAMAX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |