C10H13N — CID 102030003
(2R)-1,2-dimethyl-2-phenylaziridine (PubChem CID 102030003) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (2R)-1,2-dimethyl-2-phenylaziridine.
| Compound Name | (2R)-1,2-dimethyl-2-phenylaziridine |
|---|---|
| PubChem CID | 102030003 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (2R)-1,2-dimethyl-2-phenylaziridine |
| SMILES | CN1C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C10H13N/c1-10(8-11(10)2)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/t10-,11?/m0/s1 |
| InChIKey | AIPKEAOFPLLFHI-VUWPPUDQSA-N |
| XLogP | 1.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|