About 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane
1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane (PubChem CID 64862518) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane |
| PubChem CID | 64862518 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CN1CC(C)(c2ccccc2)NCC12CCCCC2 |
| InChI | InChI=1S/C17H26N2/c1-16(15-9-5-3-6-10-15)14-19(2)17(13-18-16)11-7-4-8-12-17/h3,5-6,9-10,18H,4,7-8,11-14H2,1-2H3 |
| InChIKey | MGYMHOWNHFIIOI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane?
The IUPAC name of 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane (CID 64862518) is 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane.
What is the SMILES notation for 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane?
The canonical SMILES for 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane is CN1CC(C)(c2ccccc2)NCC12CCCCC2.
What is the InChIKey of 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane?
The InChIKey is MGYMHOWNHFIIOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2/c1-16(15-9-5-3-6-10-15)14-19(2)17(13-18-16)11-7-4-8-12-17/h3,5-6,9-10,18H,4,7-8,11-14H2,1-2H3.
What are the key properties of 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane?
1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane has a molecular weight of 258.41 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-3-phenyl-1,4-diazaspiro[5.5]undecane is sourced from PubChem (CID 64862518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).