C14H11F3 — CID 122232924
7-phenyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene (PubChem CID 122232924) has the molecular formula C14H11F3 and a molecular weight of 236.24 g/mol. Its IUPAC name is 7-phenyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene.
| Compound Name | 7-phenyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 122232924 |
| Molecular Formula | C14H11F3 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 7-phenyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene |
| SMILES | FC(F)(F)C1(c2ccccc2)C=CC=CC=C1 |
| InChI | InChI=1S/C14H11F3/c15-14(16,17)13(10-6-1-2-7-11-13)12-8-4-3-5-9-12/h1-11H |
| InChIKey | MTKGCXXTIAEGKA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |