C14H11F3N2 — CID 86257544
2-phenyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole (PubChem CID 86257544) has the molecular formula C14H11F3N2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-phenyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole.
| Compound Name | 2-phenyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole |
|---|---|
| PubChem CID | 86257544 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-phenyl-2-(trifluoromethyl)-1,3-dihydrobenzimidazole |
| SMILES | FC(F)(F)C1(c2ccccc2)Nc2ccccc2N1 |
| InChI | InChI=1S/C14H11F3N2/c15-14(16,17)13(10-6-2-1-3-7-10)18-11-8-4-5-9-12(11)19-13/h1-9,18-19H |
| InChIKey | BKNAQGCKMRHPBP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |