C13H11IN2 — CID 174916571
2-iodo-2-phenyl-1,3-dihydrobenzimidazole (PubChem CID 174916571) has the molecular formula C13H11IN2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-iodo-2-phenyl-1,3-dihydrobenzimidazole.
| Compound Name | 2-iodo-2-phenyl-1,3-dihydrobenzimidazole |
|---|---|
| PubChem CID | 174916571 |
| Molecular Formula | C13H11IN2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-iodo-2-phenyl-1,3-dihydrobenzimidazole |
| SMILES | IC1(c2ccccc2)Nc2ccccc2N1 |
| InChI | InChI=1S/C13H11IN2/c14-13(10-6-2-1-3-7-10)15-11-8-4-5-9-12(11)16-13/h1-9,15-16H |
| InChIKey | GASADMZGNMWQSY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|