C18H15F6NO — CID 159915568
(3S,5S)-3,5-diphenyl-3,5-bis(trifluoromethyl)morpholine (PubChem CID 159915568) has the molecular formula C18H15F6NO and a molecular weight of 375.31 g/mol. Its IUPAC name is (3S,5S)-3,5-diphenyl-3,5-bis(trifluoromethyl)morpholine.
| Compound Name | (3S,5S)-3,5-diphenyl-3,5-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 159915568 |
| Molecular Formula | C18H15F6NO |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (3S,5S)-3,5-diphenyl-3,5-bis(trifluoromethyl)morpholine |
| SMILES | FC(F)(F)[C@]1(c2ccccc2)COC[C@@](c2ccccc2)(C(F)(F)F)N1 |
| InChI | InChI=1S/C18H15F6NO/c19-17(20,21)15(13-7-3-1-4-8-13)11-26-12-16(25-15,18(22,23)24)14-9-5-2-6-10-14/h1-10,25H,11-12H2/t15-,16-/m1/s1 |
| InChIKey | NXSVCRIDXHLAME-HZPDHXFCSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |