C16H12F3N3OS — CID 95989266
(2R,10aS)-2-phenyl-2-(trifluoromethyl)-3,10a-dihydro-1H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one (PubChem CID 95989266) has the molecular formula C16H12F3N3OS and a molecular weight of 351.35 g/mol. Its IUPAC name is (2R,10aS)-2-phenyl-2-(trifluoromethyl)-3,10a-dihydro-1H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | (2R,10aS)-2-phenyl-2-(trifluoromethyl)-3,10a-dihydro-1H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 95989266 |
| Molecular Formula | C16H12F3N3OS |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (2R,10aS)-2-phenyl-2-(trifluoromethyl)-3,10a-dihydro-1H-[1,3,5]triazino[2,1-b][1,3]benzothiazol-4-one |
| SMILES | O=C1N[C@@](c2ccccc2)(C(F)(F)F)N[C@@H]2Sc3ccccc3N12 |
| InChI | InChI=1S/C16H12F3N3OS/c17-16(18,19)15(10-6-2-1-3-7-10)20-13(23)22-11-8-4-5-9-12(11)24-14(22)21-15/h1-9,14,21H,(H,20,23)/t14-,15+/m0/s1 |
| InChIKey | YVBJJKXAZWEZSC-LSDHHAIUSA-N |
| XLogP | 3.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |