C28H32O — CID 102401506
(3R)-2,2-bis(4-tert-butylphenyl)-3-phenyloxirane (PubChem CID 102401506) has the molecular formula C28H32O and a molecular weight of 384.56 g/mol. Its IUPAC name is (3R)-2,2-bis(4-tert-butylphenyl)-3-phenyloxirane.
| Compound Name | (3R)-2,2-bis(4-tert-butylphenyl)-3-phenyloxirane |
|---|---|
| PubChem CID | 102401506 |
| Molecular Formula | C28H32O |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3R)-2,2-bis(4-tert-butylphenyl)-3-phenyloxirane |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32O/c1-26(2,3)21-12-16-23(17-13-21)28(25(29-28)20-10-8-7-9-11-20)24-18-14-22(15-19-24)27(4,5)6/h7-19,25H,1-6H3/t25-/m1/s1 |
| InChIKey | YLOVRJCSJXTIBA-RUZDIDTESA-N |
| XLogP | 7.30 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|