C11H12O3S2 — CID 10706239
(2R)-2-phenyl-1-oxa-4λ4,8λ4-dithiaspiro[2.5]octane 4,8-dioxide (PubChem CID 10706239) has the molecular formula C11H12O3S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (2R)-2-phenyl-1-oxa-4λ4,8λ4-dithiaspiro[2.5]octane 4,8-dioxide.
| Compound Name | (2R)-2-phenyl-1-oxa-4λ4,8λ4-dithiaspiro[2.5]octane 4,8-dioxide |
|---|---|
| PubChem CID | 10706239 |
| Molecular Formula | C11H12O3S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (2R)-2-phenyl-1-oxa-4λ4,8λ4-dithiaspiro[2.5]octane 4,8-dioxide |
| SMILES | O=S1CCCS(=O)C12O[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C11H12O3S2/c12-15-7-4-8-16(13)11(15)10(14-11)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2/t10-,11?,15?,16?/m1/s1 |
| InChIKey | IGZHDQTUPWSEOY-NYEVEFJDSA-N |
| XLogP | 1.31 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|